| Name |
3-(Azetidin-3-yl)-[1,2,4]triazolo[4,3-a]pyrazine;2,2,2-trifluoroacetic acid
|
| Molecular Formula |
C10H10F3N5O2
|
| Molecular Weight |
289.21
|
| Smiles |
O=C(O)C(F)(F)F.c1cn2c(C3CNC3)nnc2cn1
|
O=C(O)C(F)(F)F.c1cn2c(C3CNC3)nnc2cn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.