| Name |
5-({[1-(aminomethyl)cyclopropyl]methyl}(methyl)amino)-2-(2,6-dioxopiperidin-3-yl)-2,3-dihydro-1H-isoindole-1,3-dione
|
| Molecular Formula |
C19H22N4O4
|
| Molecular Weight |
370.4
|
| Smiles |
CN(CC1(CN)CC1)c1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O
|
CN(CC1(CN)CC1)c1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.