| Name |
4-[({1-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-1H-1,2,3-triazol-4-yl}methyl)amino]-2-(2,6-dioxopiperidin-3-yl)-2,3-dihydro-1H-isoindole-1,3-dione
|
| Molecular Formula |
C25H21ClN6O4
|
| Molecular Weight |
504.9
|
| Smiles |
O=C1CCC(N2C(=O)c3cccc(NCc4cn(C5CCc6cc(Cl)ccc65)nn4)c3C2=O)C(=O)N1
|
O=C1CCC(N2C(=O)c3cccc(NCc4cn(C5CCc6cc(Cl)ccc65)nn4)c3C2=O)C(=O)N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.