| Name |
N-[5-(4-{5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl}piperazin-1-yl)pyridin-2-yl]-2,2-dimethylpropanamide
|
| Molecular Formula |
C21H28N8O
|
| Molecular Weight |
408.5
|
| Smiles |
Cc1nc2ncnn2c(N2CCN(c3ccc(NC(=O)C(C)(C)C)nc3)CC2)c1C
|
Cc1nc2ncnn2c(N2CCN(c3ccc(NC(=O)C(C)(C)C)nc3)CC2)c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.