| Name |
3-Methyl-5-(3-{[1,2,4]triazolo[4,3-a]pyridin-3-yl}azetidin-1-yl)-1,2,4-thiadiazole
|
| Molecular Formula |
C12H12N6S
|
| Molecular Weight |
272.33
|
| Smiles |
Cc1nsc(N2CC(c3nnc4ccccn34)C2)n1
|
Cc1nsc(N2CC(c3nnc4ccccn34)C2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.