| Name |
7-(3,5-dimethoxybenzoyl)-6H,7H,8H,9H-pyrido[2,3-b]1,6-naphthyridine
|
| Molecular Formula |
C20H19N3O3
|
| Molecular Weight |
349.4
|
| Smiles |
COc1cc(OC)cc(C(=O)N2CCc3nc4ncccc4cc3C2)c1
|
COc1cc(OC)cc(C(=O)N2CCc3nc4ncccc4cc3C2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.