| Name |
5-cyclopropyl-3-({6H,7H,8H,9H-pyrido[2,3-b]1,6-naphthyridin-7-yl}methyl)-1,2-oxazole
|
| Molecular Formula |
C18H18N4O
|
| Molecular Weight |
306.4
|
| Smiles |
c1cnc2nc3c(cc2c1)CN(Cc1cc(C2CC2)on1)CC3
|
c1cnc2nc3c(cc2c1)CN(Cc1cc(C2CC2)on1)CC3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.