| Name |
4-(4-Chlorophenyl)-1-{5-methylpyrazolo[1,5-a]pyrimidin-7-yl}piperidin-4-ol
|
| Molecular Formula |
C18H19ClN4O
|
| Molecular Weight |
342.8
|
| Smiles |
Cc1cc(N2CCC(O)(c3ccc(Cl)cc3)CC2)n2nccc2n1
|
Cc1cc(N2CCC(O)(c3ccc(Cl)cc3)CC2)n2nccc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.