| Name |
2-Cyclopropyl-4-{4-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]piperazin-1-yl}-5,6-dimethylpyrimidine
|
| Molecular Formula |
C19H27N5S
|
| Molecular Weight |
357.5
|
| Smiles |
Cc1nc(C)c(CN2CCN(c3nc(C4CC4)nc(C)c3C)CC2)s1
|
Cc1nc(C)c(CN2CCN(c3nc(C4CC4)nc(C)c3C)CC2)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.