| Name |
2-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-4-one
|
| Molecular Formula |
C13H12FN3O
|
| Molecular Weight |
245.25
|
| Smiles |
O=C1NCCCn2nc(-c3ccc(F)cc3)cc21
|
O=C1NCCCn2nc(-c3ccc(F)cc3)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.