| Name |
[(8R,9S,10R,13S,14S)-17-[N-(carbamothioylamino)-C-methylcarbonimidoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
|
| Molecular Formula |
C24H35N3O2S
|
| Molecular Weight |
429.6
|
| Smiles |
CC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)=NNC(N)=S)=CCC32)C1
|
CC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)=NNC(N)=S)=CCC32)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.