| Name |
Rel-(3R,4R,5S)-tert-butyl 4-amino-3-((4,4-difluorocyclohexyl)methoxy)-5-methoxypiperidine-1-carboxylate
|
| Molecular Formula |
C18H32F2N2O4
|
| Molecular Weight |
378.5
|
| Smiles |
COC1CN(C(=O)OC(C)(C)C)CC(OCC2CCC(F)(F)CC2)C1N
|
COC1CN(C(=O)OC(C)(C)C)CC(OCC2CCC(F)(F)CC2)C1N
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.