| Name |
N-(2-{[2,2'-bithiophene]-5-yl}ethyl)-N'-(5-chloro-2-methoxyphenyl)ethanediamide
|
| Molecular Formula |
C19H17ClN2O3S2
|
| Molecular Weight |
420.9
|
| Smiles |
COc1ccc(Cl)cc1NC(=O)C(=O)NCCc1ccc(-c2cccs2)s1
|
COc1ccc(Cl)cc1NC(=O)C(=O)NCCc1ccc(-c2cccs2)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.