| Name |
2-tert-Butyl 6,7-dimethyl 3,4-dihydroisoquinoline-2,6,7(1H)-tricarboxylate
|
| Molecular Formula |
C18H23NO6
|
| Molecular Weight |
349.4
|
| Smiles |
COC(=O)c1cc2c(cc1C(=O)OC)CN(C(=O)OC(C)(C)C)CC2
|
COC(=O)c1cc2c(cc1C(=O)OC)CN(C(=O)OC(C)(C)C)CC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.