| Name |
8-Benzyl 3-ethyl (3R)-1,1'-diaza[2,8'-bispiro[4.5]decane]-3,8-dicarboxylate
|
| Molecular Formula |
C29H42N2O4
|
| Molecular Weight |
482.7
|
| Smiles |
CCOC(=O)C1CC2(CCC(C(=O)OCc3ccccc3)CC2)NC1C1CCC2(CCCN2)CC1
|
CCOC(=O)C1CC2(CCC(C(=O)OCc3ccccc3)CC2)NC1C1CCC2(CCCN2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.