| Name |
N-[[4-(Aminomethyl)-2-fluorophenyl]methyl]spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxamide;hydrochloride
|
| Molecular Formula |
C20H22ClFN2O2
|
| Molecular Weight |
376.8
|
| Smiles |
Cl.NCc1ccc(CNC(=O)C2CC23CCOc2ccccc23)c(F)c1
|
Cl.NCc1ccc(CNC(=O)C2CC23CCOc2ccccc23)c(F)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.