| Name |
2-Oxospiro[1H-indole-3,3'-pyrrolidine]-1'-sulfonyl fluoride
|
| Molecular Formula |
C11H11FN2O3S
|
| Molecular Weight |
270.28
|
| Smiles |
O=C1Nc2ccccc2C12CCN(S(=O)(=O)F)C2
|
O=C1Nc2ccccc2C12CCN(S(=O)(=O)F)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.