| Name |
5-[(2,5-difluorophenyl)methyl]-2-(3-methoxyphenyl)-4H,5H-pyrazolo[1,5-a]pyrazin-4-one
|
| Molecular Formula |
C20H15F2N3O2
|
| Molecular Weight |
367.3
|
| Smiles |
COc1cccc(-c2cc3c(=O)n(Cc4cc(F)ccc4F)ccn3n2)c1
|
COc1cccc(-c2cc3c(=O)n(Cc4cc(F)ccc4F)ccn3n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.