| Name |
1-Ethyl-6-fluoro-7-(4-{[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl}piperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
|
| Molecular Formula |
C25H23F2N5O4
|
| Molecular Weight |
495.5
|
| Smiles |
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(Cc4nnc(-c5ccc(F)cc5)o4)CC3)cc21
|
CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(Cc4nnc(-c5ccc(F)cc5)o4)CC3)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.