| Name |
(2-{5,6-Dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl}-octahydrocyclopenta[c]pyrrol-3a-yl)methanol
|
| Molecular Formula |
C15H21N5O
|
| Molecular Weight |
287.36
|
| Smiles |
Cc1nc2ncnn2c(N2CC3CCCC3(CO)C2)c1C
|
Cc1nc2ncnn2c(N2CC3CCCC3(CO)C2)c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.