| Name |
1-(2-{3-[(4-chloro-1H-pyrazol-1-yl)methyl]azetidin-1-yl}ethyl)-1H-1,2,3-triazole
|
| Molecular Formula |
C11H15ClN6
|
| Molecular Weight |
266.73
|
| Smiles |
Clc1cnn(CC2CN(CCn3ccnn3)C2)c1
|
Clc1cnn(CC2CN(CCn3ccnn3)C2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.