| Name |
4,5,6,7-Tetrachloro-1,3-dioxoisoindolin-2-yl 3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylate
|
| Molecular Formula |
C15H6Cl4F3NO4
|
| Molecular Weight |
463.0
|
| Smiles |
O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1OC(=O)C12CC(C(F)(F)F)(C1)C2
|
O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1OC(=O)C12CC(C(F)(F)F)(C1)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.