| Name |
2-(1,4-Difluorodibenzo[b,d]thiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
|
| Molecular Formula |
C18H17BF2O2S
|
| Molecular Weight |
346.2
|
| Smiles |
CC1(C)OB(c2cc(F)c3sc4ccccc4c3c2F)OC1(C)C
|
CC1(C)OB(c2cc(F)c3sc4ccccc4c3c2F)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.