| Name |
3-chloro-4-[(1-{7-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl}piperidin-4-yl)methoxy]pyridine
|
| Molecular Formula |
C18H20ClN5O
|
| Molecular Weight |
357.8
|
| Smiles |
Cn1ccc2c(N3CCC(COc4ccncc4Cl)CC3)ncnc21
|
Cn1ccc2c(N3CCC(COc4ccncc4Cl)CC3)ncnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.