| Name |
N-(6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-yl)-1,1-diphenylmethanimine
|
| Molecular Formula |
C22H18ClN3
|
| Molecular Weight |
359.8
|
| Smiles |
Cc1nc2c(N=C(c3ccccc3)c3ccccc3)cc(Cl)cn2c1C
|
Cc1nc2c(N=C(c3ccccc3)c3ccccc3)cc(Cl)cn2c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.