| Name |
2-Chloro-4-(1,3-dioxolan-2-yl)-1,3-thiazole-5-sulfonyl chloride
|
| Molecular Formula |
C6H5Cl2NO4S2
|
| Molecular Weight |
290.1
|
| Smiles |
O=S(=O)(Cl)c1sc(Cl)nc1C1OCCO1
|
O=S(=O)(Cl)c1sc(Cl)nc1C1OCCO1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.