| Name |
5,5-Dimethyl-3-[(2,3,4,5,6-pentafluorophenoxy)methanesulfonyl]-4,5-dihydro-1,2-oxazole
|
| Molecular Formula |
C12H10F5NO4S
|
| Molecular Weight |
359.27
|
| Smiles |
CC1(C)CC(S(=O)(=O)COc2c(F)c(F)c(F)c(F)c2F)=NO1
|
CC1(C)CC(S(=O)(=O)COc2c(F)c(F)c(F)c(F)c2F)=NO1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.