| Name |
3-({4-[6-(oxan-4-yl)pyrimidin-4-yl]piperazin-1-yl}methyl)-4,5,6,7-tetrahydro-1H-indazole
|
| Molecular Formula |
C21H30N6O
|
| Molecular Weight |
382.5
|
| Smiles |
c1nc(C2CCOCC2)cc(N2CCN(Cc3n[nH]c4c3CCCC4)CC2)n1
|
c1nc(C2CCOCC2)cc(N2CCN(Cc3n[nH]c4c3CCCC4)CC2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.