| Name |
2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,4-oxadiazole
|
| Molecular Formula |
C9H15BN2O3
|
| Molecular Weight |
210.04
|
| Smiles |
Cc1nnc(B2OC(C)(C)C(C)(C)O2)o1
|
Cc1nnc(B2OC(C)(C)C(C)(C)O2)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.