| Name |
5-fluoro-N,6-dimethyl-N-[(1-{pyrazolo[1,5-a]pyrazin-4-yl}piperidin-4-yl)methyl]pyrimidin-4-amine
|
| Molecular Formula |
C18H22FN7
|
| Molecular Weight |
355.4
|
| Smiles |
Cc1ncnc(N(C)CC2CCN(c3nccn4nccc34)CC2)c1F
|
Cc1ncnc(N(C)CC2CCN(c3nccn4nccc34)CC2)c1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.