| Name |
4-(5-{3-Ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl}-octahydropyrrolo[3,4-c]pyrrol-2-yl)-2-(trifluoromethyl)pyridine
|
| Molecular Formula |
C19H20F3N7
|
| Molecular Weight |
403.4
|
| Smiles |
CCc1nnc2ccc(N3CC4CN(c5ccnc(C(F)(F)F)c5)CC4C3)nn12
|
CCc1nnc2ccc(N3CC4CN(c5ccnc(C(F)(F)F)c5)CC4C3)nn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.