| Name |
cis-1'-Tert-butyl 6A-methyl hexahydro-1H-spiro[cyclopenta[C]pyrrole-4,4'-piperidine]-1',6A-dicarboxylate
|
| Molecular Formula |
C18H30N2O4
|
| Molecular Weight |
338.4
|
| Smiles |
COC(=O)C12CCC3(CCN(C(=O)OC(C)(C)C)CC3)C1CNC2
|
COC(=O)C12CCC3(CCN(C(=O)OC(C)(C)C)CC3)C1CNC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.