| Name |
2-Methyl-6-{4-[6-(pyridin-4-yl)-1,8-naphthyridin-2-yl]piperidine-1-carbonyl}-2,3-dihydropyridazin-3-one
|
| Molecular Formula |
C24H22N6O2
|
| Molecular Weight |
426.5
|
| Smiles |
Cn1nc(C(=O)N2CCC(c3ccc4cc(-c5ccncc5)cnc4n3)CC2)ccc1=O
|
Cn1nc(C(=O)N2CCC(c3ccc4cc(-c5ccncc5)cnc4n3)CC2)ccc1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.