| Name |
4,4-Difluoro-1-{1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidine-4-carbonyl}piperidine
|
| Molecular Formula |
C16H23F2N3OS
|
| Molecular Weight |
343.4
|
| Smiles |
Cc1nc(CN2CCC(C(=O)N3CCC(F)(F)CC3)CC2)cs1
|
Cc1nc(CN2CCC(C(=O)N3CCC(F)(F)CC3)CC2)cs1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.