| Name |
N,N-dimethyl-6-(4-{thieno[2,3-d]pyrimidin-4-yl}piperazin-1-yl)pyridazin-3-amine
|
| Molecular Formula |
C16H19N7S
|
| Molecular Weight |
341.4
|
| Smiles |
CN(C)c1ccc(N2CCN(c3ncnc4sccc34)CC2)nn1
|
CN(C)c1ccc(N2CCN(c3ncnc4sccc34)CC2)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.