| Name |
N-ethyl-6-methyl-2-(4-{pyrazolo[1,5-a]pyrimidin-5-yl}piperazin-1-yl)pyrimidin-4-amine
|
| Molecular Formula |
C17H22N8
|
| Molecular Weight |
338.4
|
| Smiles |
CCNc1cc(C)nc(N2CCN(c3ccn4nccc4n3)CC2)n1
|
CCNc1cc(C)nc(N2CCN(c3ccn4nccc4n3)CC2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.