| Name |
(1-{[5-(Trifluoromethyl)-1,3,4-oxadiazol-2-yl]methyl}piperidin-4-yl)methanol
|
| Molecular Formula |
C10H14F3N3O2
|
| Molecular Weight |
265.23
|
| Smiles |
OCC1CCN(Cc2nnc(C(F)(F)F)o2)CC1
|
OCC1CCN(Cc2nnc(C(F)(F)F)o2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.