| Name |
2-(Morpholine-4-carbonyl)-4-{thieno[2,3-d]pyrimidin-4-yl}morpholine
|
| Molecular Formula |
C15H18N4O3S
|
| Molecular Weight |
334.4
|
| Smiles |
O=C(C1CN(c2ncnc3sccc23)CCO1)N1CCOCC1
|
O=C(C1CN(c2ncnc3sccc23)CCO1)N1CCOCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.