| Name |
3,5-dimethyl-4-(5-{2-methyl-5H,6H,7H-cyclopenta[d]pyrimidin-4-yl}-octahydropyrrolo[3,4-c]pyrrole-2-carbonyl)-1,2-oxazole
|
| Molecular Formula |
C20H25N5O2
|
| Molecular Weight |
367.4
|
| Smiles |
Cc1nc2c(c(N3CC4CN(C(=O)c5c(C)noc5C)CC4C3)n1)CCC2
|
Cc1nc2c(c(N3CC4CN(C(=O)c5c(C)noc5C)CC4C3)n1)CCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.