| Name |
N-[(3,5-dimethoxyphenyl)methyl]-3-{4-oxo-4H,5H-pyrazolo[1,5-a]pyrazin-5-yl}propanamide
|
| Molecular Formula |
C18H20N4O4
|
| Molecular Weight |
356.4
|
| Smiles |
COc1cc(CNC(=O)CCn2ccn3nccc3c2=O)cc(OC)c1
|
COc1cc(CNC(=O)CCn2ccn3nccc3c2=O)cc(OC)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.