| Name |
3-Ethyl-6-[5-(3-methylbenzenesulfonyl)-octahydropyrrolo[3,4-c]pyrrol-2-yl]-[1,2,4]triazolo[4,3-b]pyridazine
|
| Molecular Formula |
C20H24N6O2S
|
| Molecular Weight |
412.5
|
| Smiles |
CCc1nnc2ccc(N3CC4CN(S(=O)(=O)c5cccc(C)c5)CC4C3)nn12
|
CCc1nnc2ccc(N3CC4CN(S(=O)(=O)c5cccc(C)c5)CC4C3)nn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.