| Name |
1-benzyl-4-({2-[(cyclopentylmethyl)sulfanyl]-4-oxo-3H,4H-thieno[3,2-d]pyrimidin-3-yl}methyl)pyrrolidin-2-one
|
| Molecular Formula |
C24H27N3O2S2
|
| Molecular Weight |
453.6
|
| Smiles |
O=C1CC(Cn2c(SCC3CCCC3)nc3ccsc3c2=O)CN1Cc1ccccc1
|
O=C1CC(Cn2c(SCC3CCCC3)nc3ccsc3c2=O)CN1Cc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.