| Name |
1-{2-Tert-butylimidazo[1,2-b]pyridazin-6-yl}-4-{5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl}piperazine
|
| Molecular Formula |
C21H27N9
|
| Molecular Weight |
405.5
|
| Smiles |
Cc1nc2ncnn2c(N2CCN(c3ccc4nc(C(C)(C)C)cn4n3)CC2)c1C
|
Cc1nc2ncnn2c(N2CCN(c3ccc4nc(C(C)(C)C)cn4n3)CC2)c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.