| Name |
N-ethyl-6-methyl-2-(4-{thieno[3,2-d]pyrimidin-4-yl}piperazin-1-yl)pyrimidin-4-amine
|
| Molecular Formula |
C17H21N7S
|
| Molecular Weight |
355.5
|
| Smiles |
CCNc1cc(C)nc(N2CCN(c3ncnc4ccsc34)CC2)n1
|
CCNc1cc(C)nc(N2CCN(c3ncnc4ccsc34)CC2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.