| Name |
Lithium(1+) 2-fluoro-2-(1,3-thiazol-5-yl)acetate
|
| Molecular Formula |
C5H3FLiNO2S
|
| Molecular Weight |
167.1
|
| Smiles |
O=C([O-])C(F)c1cncs1.[Li+]
|
O=C([O-])C(F)c1cncs1.[Li+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.