| Name |
2-{5-[2-(Trifluoromethyl)benzenesulfonyl]-octahydropyrrolo[3,4-c]pyrrol-2-yl}-1,3-thiazole
|
| Molecular Formula |
C16H16F3N3O2S2
|
| Molecular Weight |
403.4
|
| Smiles |
O=S(=O)(c1ccccc1C(F)(F)F)N1CC2CN(c3nccs3)CC2C1
|
O=S(=O)(c1ccccc1C(F)(F)F)N1CC2CN(c3nccs3)CC2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.