| Name |
Carbamic acid, N,Na(2)-(1,3-dioxo-1,3-propanediyl)bis-, C,Ca(2)-dibutyl ester
|
| Molecular Formula |
C13H22N2O6
|
| Molecular Weight |
302.32
|
| Smiles |
CCCCOC(=O)NC(=O)CC(=O)NC(=O)OCCCC
|
CCCCOC(=O)NC(=O)CC(=O)NC(=O)OCCCC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.