| Name |
(4-Bromophenyl)methyl bis(2,2,2-trifluoroethyl) phosphate
|
| Molecular Formula |
C11H10BrF6O4P
|
| Molecular Weight |
431.06
|
| Smiles |
O=P(OCc1ccc(Br)cc1)(OCC(F)(F)F)OCC(F)(F)F
|
O=P(OCc1ccc(Br)cc1)(OCC(F)(F)F)OCC(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.