| Name |
3-[2-Chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorophenyl]-5-methyl-4,5-dihydro-1,2-oxazole-5-carboxylic acid
|
| Molecular Formula |
C16H14ClFN4O5S
|
| Molecular Weight |
428.8
|
| Smiles |
Cn1c(=S)n(C)c(=O)n(-c2cc(C3=NOC(C)(C(=O)O)C3)c(Cl)cc2F)c1=O
|
Cn1c(=S)n(C)c(=O)n(-c2cc(C3=NOC(C)(C(=O)O)C3)c(Cl)cc2F)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.