| Name |
5-fluoro-2-(4-{2-methyl-5H,6H,7H-cyclopenta[d]pyrimidin-4-yl}piperazin-1-yl)pyrimidine
|
| Molecular Formula |
C16H19FN6
|
| Molecular Weight |
314.36
|
| Smiles |
Cc1nc2c(c(N3CCN(c4ncc(F)cn4)CC3)n1)CCC2
|
Cc1nc2c(c(N3CCN(c4ncc(F)cn4)CC3)n1)CCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.